About 2-but-1-en-2-ylaniline
2-but-1-en-2-ylaniline (PubChem CID 10582919) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-but-1-en-2-ylaniline.
Molecular Properties
| Compound Name | 2-but-1-en-2-ylaniline |
| PubChem CID | 10582919 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2-but-1-en-2-ylaniline |
| SMILES | C=C(CC)c1ccccc1N |
| InChI | InChI=1S/C10H13N/c1-3-8(2)9-6-4-5-7-10(9)11/h4-7H,2-3,11H2,1H3 |
| InChIKey | ZLAKJVYSXLRGSJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-but-1-en-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-en-2-ylaniline?
The IUPAC name of 2-but-1-en-2-ylaniline (CID 10582919) is 2-but-1-en-2-ylaniline.
What is the SMILES notation for 2-but-1-en-2-ylaniline?
The canonical SMILES for 2-but-1-en-2-ylaniline is C=C(CC)c1ccccc1N.
What is the InChIKey of 2-but-1-en-2-ylaniline?
The InChIKey is ZLAKJVYSXLRGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-3-8(2)9-6-4-5-7-10(9)11/h4-7H,2-3,11H2,1H3.
What are the key properties of 2-but-1-en-2-ylaniline?
2-but-1-en-2-ylaniline has a molecular weight of 147.22 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-en-2-ylaniline is sourced from PubChem (CID 10582919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).