About 2-aminobenzoate;ethylazanium
2-aminobenzoate;ethylazanium (PubChem CID 160595326) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-aminobenzoate;ethylazanium.
Molecular Properties
| Compound Name | 2-aminobenzoate;ethylazanium |
| PubChem CID | 160595326 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-aminobenzoate;ethylazanium |
| SMILES | CC[NH3+].Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C7H7NO2.C2H7N/c8-6-4-2-1-3-5(6)7(9)10;1-2-3/h1-4H,8H2,(H,9,10);2-3H2,1H3 |
| InChIKey | RDOAYUJFJPLXKB-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzoate;ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzoate;ethylazanium?
The IUPAC name of 2-aminobenzoate;ethylazanium (CID 160595326) is 2-aminobenzoate;ethylazanium.
What is the SMILES notation for 2-aminobenzoate;ethylazanium?
The canonical SMILES for 2-aminobenzoate;ethylazanium is CC[NH3+].Nc1ccccc1C(=O)[O-].
What is the InChIKey of 2-aminobenzoate;ethylazanium?
The InChIKey is RDOAYUJFJPLXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C2H7N/c8-6-4-2-1-3-5(6)7(9)10;1-2-3/h1-4H,8H2,(H,9,10);2-3H2,1H3.
What are the key properties of 2-aminobenzoate;ethylazanium?
2-aminobenzoate;ethylazanium has a molecular weight of 182.22 g/mol, XLogP of -1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzoate;ethylazanium is sourced from PubChem (CID 160595326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).