About bis(2-aminobenzoate);dibutyltin(2+)
bis(2-aminobenzoate);dibutyltin(2+) (PubChem CID 22925318) has the molecular formula C22H30N2O4Sn
and a molecular weight of 505.20 g/mol. Its IUPAC name is bis(2-aminobenzoate);dibutyltin(2+).
Molecular Properties
| Compound Name | bis(2-aminobenzoate);dibutyltin(2+) |
| PubChem CID | 22925318 |
| Molecular Formula | C22H30N2O4Sn |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | bis(2-aminobenzoate);dibutyltin(2+) |
| SMILES | CCCC[Sn+2]CCCC.Nc1ccccc1C(=O)[O-].Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/2C7H7NO2.2C4H9.Sn/c2*8-6-4-2-1-3-5(6)7(9)10;2*1-3-4-2;/h2*1-4H,8H2,(H,9,10);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | LDBMDAOPOKTMEV-UHFFFAOYSA-L |
| XLogP | 2.39 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bis(2-aminobenzoate);dibutyltin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminobenzoate);dibutyltin(2+)?
The IUPAC name of bis(2-aminobenzoate);dibutyltin(2+) (CID 22925318) is bis(2-aminobenzoate);dibutyltin(2+).
What is the SMILES notation for bis(2-aminobenzoate);dibutyltin(2+)?
The canonical SMILES for bis(2-aminobenzoate);dibutyltin(2+) is CCCC[Sn+2]CCCC.Nc1ccccc1C(=O)[O-].Nc1ccccc1C(=O)[O-].
What is the InChIKey of bis(2-aminobenzoate);dibutyltin(2+)?
The InChIKey is LDBMDAOPOKTMEV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H7NO2.2C4H9.Sn/c2*8-6-4-2-1-3-5(6)7(9)10;2*1-3-4-2;/h2*1-4H,8H2,(H,9,10);2*1,3-4H2,2H3;/q;;;;+2/p-2.
What are the key properties of bis(2-aminobenzoate);dibutyltin(2+)?
bis(2-aminobenzoate);dibutyltin(2+) has a molecular weight of 505.20 g/mol, XLogP of 2.39, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminobenzoate);dibutyltin(2+) is sourced from PubChem (CID 22925318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).