About 2-aminobenzamide;pentan-1-amine
2-aminobenzamide;pentan-1-amine (PubChem CID 174724084) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-aminobenzamide;pentan-1-amine.
Molecular Properties
| Compound Name | 2-aminobenzamide;pentan-1-amine |
| PubChem CID | 174724084 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-aminobenzamide;pentan-1-amine |
| SMILES | CCCCCN.NC(=O)c1ccccc1N |
| InChI | InChI=1S/C7H8N2O.C5H13N/c8-6-4-2-1-3-5(6)7(9)10;1-2-3-4-5-6/h1-4H,8H2,(H2,9,10);2-6H2,1H3 |
| InChIKey | CRIRCQJSSUBTTO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzamide;pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzamide;pentan-1-amine?
The IUPAC name of 2-aminobenzamide;pentan-1-amine (CID 174724084) is 2-aminobenzamide;pentan-1-amine.
What is the SMILES notation for 2-aminobenzamide;pentan-1-amine?
The canonical SMILES for 2-aminobenzamide;pentan-1-amine is CCCCCN.NC(=O)c1ccccc1N.
What is the InChIKey of 2-aminobenzamide;pentan-1-amine?
The InChIKey is CRIRCQJSSUBTTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C5H13N/c8-6-4-2-1-3-5(6)7(9)10;1-2-3-4-5-6/h1-4H,8H2,(H2,9,10);2-6H2,1H3.
What are the key properties of 2-aminobenzamide;pentan-1-amine?
2-aminobenzamide;pentan-1-amine has a molecular weight of 223.32 g/mol, XLogP of 1.50, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzamide;pentan-1-amine is sourced from PubChem (CID 174724084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).