About ethane;hexane;2-hydroxybenzamide
ethane;hexane;2-hydroxybenzamide (PubChem CID 143703157) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is ethane;hexane;2-hydroxybenzamide.
Molecular Properties
| Compound Name | ethane;hexane;2-hydroxybenzamide |
| PubChem CID | 143703157 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | ethane;hexane;2-hydroxybenzamide |
| SMILES | CC.CCCCCC.NC(=O)c1ccccc1O |
| InChI | InChI=1S/C7H7NO2.C6H14.C2H6/c8-7(10)5-3-1-2-4-6(5)9;1-3-5-6-4-2;1-2/h1-4,9H,(H2,8,10);3-6H2,1-2H3;1-2H3 |
| InChIKey | VGBHTZXAKBNTLB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;hexane;2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hexane;2-hydroxybenzamide?
The IUPAC name of ethane;hexane;2-hydroxybenzamide (CID 143703157) is ethane;hexane;2-hydroxybenzamide.
What is the SMILES notation for ethane;hexane;2-hydroxybenzamide?
The canonical SMILES for ethane;hexane;2-hydroxybenzamide is CC.CCCCCC.NC(=O)c1ccccc1O.
What is the InChIKey of ethane;hexane;2-hydroxybenzamide?
The InChIKey is VGBHTZXAKBNTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C6H14.C2H6/c8-7(10)5-3-1-2-4-6(5)9;1-3-5-6-4-2;1-2/h1-4,9H,(H2,8,10);3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;hexane;2-hydroxybenzamide?
ethane;hexane;2-hydroxybenzamide has a molecular weight of 253.39 g/mol, XLogP of 4.10, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hexane;2-hydroxybenzamide is sourced from PubChem (CID 143703157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).