2-hydroxybenzamide;2-propylpentanoic acid

C15H23NO4 — CID 21127409

IUPAC2-hydroxybenzamide;2-propylpentanoic acid
SMILESCCCC(CCC)C(=O)O.NC(=O)c1ccccc1O
InChIInChI=1S/C8H16O2.C7H7NO2/c1-3-5-7(6-4-2)8(9)10;8-7(10)5-3-1-2-4-6(5)9/h7H,3-6H2,1-2H3,(H,9,10);1-4,9H,(H2,8,10)
InChIKeyQEECJBAGZGANAF-UHFFFAOYSA-N
MW281.35 g/mol
LogP2.78
Rot. Bonds6

About 2-hydroxybenzamide;2-propylpentanoic acid

2-hydroxybenzamide;2-propylpentanoic acid (PubChem CID 21127409) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-hydroxybenzamide;2-propylpentanoic acid.

Molecular Properties

Compound Name2-hydroxybenzamide;2-propylpentanoic acid
PubChem CID21127409
Molecular FormulaC15H23NO4
Molecular Weight281.35 g/mol
Exact Mass281.16
IUPAC Name2-hydroxybenzamide;2-propylpentanoic acid
SMILESCCCC(CCC)C(=O)O.NC(=O)c1ccccc1O
InChIInChI=1S/C8H16O2.C7H7NO2/c1-3-5-7(6-4-2)8(9)10;8-7(10)5-3-1-2-4-6(5)9/h7H,3-6H2,1-2H3,(H,9,10);1-4,9H,(H2,8,10)
InChIKeyQEECJBAGZGANAF-UHFFFAOYSA-N
XLogP2.78
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.35
LogP ≤ 52.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-hydroxybenzamide;2-propylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxybenzamide;2-propylpentanoic acid?
The IUPAC name of 2-hydroxybenzamide;2-propylpentanoic acid (CID 21127409) is 2-hydroxybenzamide;2-propylpentanoic acid.
What is the SMILES notation for 2-hydroxybenzamide;2-propylpentanoic acid?
The canonical SMILES for 2-hydroxybenzamide;2-propylpentanoic acid is CCCC(CCC)C(=O)O.NC(=O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzamide;2-propylpentanoic acid?
The InChIKey is QEECJBAGZGANAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C7H7NO2/c1-3-5-7(6-4-2)8(9)10;8-7(10)5-3-1-2-4-6(5)9/h7H,3-6H2,1-2H3,(H,9,10);1-4,9H,(H2,8,10).
What are the key properties of 2-hydroxybenzamide;2-propylpentanoic acid?
2-hydroxybenzamide;2-propylpentanoic acid has a molecular weight of 281.35 g/mol, XLogP of 2.78, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzamide;2-propylpentanoic acid is sourced from PubChem (CID 21127409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).