C15H23NO4 — CID 21127409
2-hydroxybenzamide;2-propylpentanoic acid (PubChem CID 21127409) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-hydroxybenzamide;2-propylpentanoic acid.
| Compound Name | 2-hydroxybenzamide;2-propylpentanoic acid |
|---|---|
| PubChem CID | 21127409 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-hydroxybenzamide;2-propylpentanoic acid |
| SMILES | CCCC(CCC)C(=O)O.NC(=O)c1ccccc1O |
| InChI | InChI=1S/C8H16O2.C7H7NO2/c1-3-5-7(6-4-2)8(9)10;8-7(10)5-3-1-2-4-6(5)9/h7H,3-6H2,1-2H3,(H,9,10);1-4,9H,(H2,8,10) |
| InChIKey | QEECJBAGZGANAF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |