About azane;2-hydroxybenzamide;phosphoric acid
azane;2-hydroxybenzamide;phosphoric acid (PubChem CID 174483158) has the molecular formula C7H19N4O6P
and a molecular weight of 286.23 g/mol. Its IUPAC name is azane;2-hydroxybenzamide;phosphoric acid.
Molecular Properties
| Compound Name | azane;2-hydroxybenzamide;phosphoric acid |
| PubChem CID | 174483158 |
| Molecular Formula | C7H19N4O6P |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | azane;2-hydroxybenzamide;phosphoric acid |
| SMILES | N.N.N.NC(=O)c1ccccc1O.O=P(O)(O)O |
| InChI | InChI=1S/C7H7NO2.3H3N.H3O4P/c8-7(10)5-3-1-2-4-6(5)9;;;;1-5(2,3)4/h1-4,9H,(H2,8,10);3*1H3;(H3,1,2,3,4) |
| InChIKey | PUGFJFKYIPZPJJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 246.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;2-hydroxybenzamide;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-hydroxybenzamide;phosphoric acid?
The IUPAC name of azane;2-hydroxybenzamide;phosphoric acid (CID 174483158) is azane;2-hydroxybenzamide;phosphoric acid.
What is the SMILES notation for azane;2-hydroxybenzamide;phosphoric acid?
The canonical SMILES for azane;2-hydroxybenzamide;phosphoric acid is N.N.N.NC(=O)c1ccccc1O.O=P(O)(O)O.
What is the InChIKey of azane;2-hydroxybenzamide;phosphoric acid?
The InChIKey is PUGFJFKYIPZPJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.3H3N.H3O4P/c8-7(10)5-3-1-2-4-6(5)9;;;;1-5(2,3)4/h1-4,9H,(H2,8,10);3*1H3;(H3,1,2,3,4).
What are the key properties of azane;2-hydroxybenzamide;phosphoric acid?
azane;2-hydroxybenzamide;phosphoric acid has a molecular weight of 286.23 g/mol, XLogP of 0.05, 1 rotatable bonds, 8 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-hydroxybenzamide;phosphoric acid is sourced from PubChem (CID 174483158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).