azane;2-hydroxybenzamide;phosphoric acid

C7H19N4O6P — CID 174483158

IUPACazane;2-hydroxybenzamide;phosphoric acid
SMILESN.N.N.NC(=O)c1ccccc1O.O=P(O)(O)O
InChIInChI=1S/C7H7NO2.3H3N.H3O4P/c8-7(10)5-3-1-2-4-6(5)9;;;;1-5(2,3)4/h1-4,9H,(H2,8,10);3*1H3;(H3,1,2,3,4)
InChIKeyPUGFJFKYIPZPJJ-UHFFFAOYSA-N
MW286.23 g/mol
LogP0.05
Rot. Bonds1

About azane;2-hydroxybenzamide;phosphoric acid

azane;2-hydroxybenzamide;phosphoric acid (PubChem CID 174483158) has the molecular formula C7H19N4O6P and a molecular weight of 286.23 g/mol. Its IUPAC name is azane;2-hydroxybenzamide;phosphoric acid.

Molecular Properties

Compound Nameazane;2-hydroxybenzamide;phosphoric acid
PubChem CID174483158
Molecular FormulaC7H19N4O6P
Molecular Weight286.23 g/mol
Exact Mass286.10
IUPAC Nameazane;2-hydroxybenzamide;phosphoric acid
SMILESN.N.N.NC(=O)c1ccccc1O.O=P(O)(O)O
InChIInChI=1S/C7H7NO2.3H3N.H3O4P/c8-7(10)5-3-1-2-4-6(5)9;;;;1-5(2,3)4/h1-4,9H,(H2,8,10);3*1H3;(H3,1,2,3,4)
InChIKeyPUGFJFKYIPZPJJ-UHFFFAOYSA-N
XLogP0.05
TPSA246.08 Ų
H-Bond Donors8
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500286.23
LogP ≤ 50.05
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze azane;2-hydroxybenzamide;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;2-hydroxybenzamide;phosphoric acid?
The IUPAC name of azane;2-hydroxybenzamide;phosphoric acid (CID 174483158) is azane;2-hydroxybenzamide;phosphoric acid.
What is the SMILES notation for azane;2-hydroxybenzamide;phosphoric acid?
The canonical SMILES for azane;2-hydroxybenzamide;phosphoric acid is N.N.N.NC(=O)c1ccccc1O.O=P(O)(O)O.
What is the InChIKey of azane;2-hydroxybenzamide;phosphoric acid?
The InChIKey is PUGFJFKYIPZPJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.3H3N.H3O4P/c8-7(10)5-3-1-2-4-6(5)9;;;;1-5(2,3)4/h1-4,9H,(H2,8,10);3*1H3;(H3,1,2,3,4).
What are the key properties of azane;2-hydroxybenzamide;phosphoric acid?
azane;2-hydroxybenzamide;phosphoric acid has a molecular weight of 286.23 g/mol, XLogP of 0.05, 1 rotatable bonds, 8 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-hydroxybenzamide;phosphoric acid is sourced from PubChem (CID 174483158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).