2,3-diphenylbenzamide;phosphoric acid

C19H18NO5P — CID 68745056

IUPAC2,3-diphenylbenzamide;phosphoric acid
SMILESNC(=O)c1cccc(-c2ccccc2)c1-c1ccccc1.O=P(O)(O)O
InChIInChI=1S/C19H15NO.H3O4P/c20-19(21)17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15;1-5(2,3)4/h1-13H,(H2,20,21);(H3,1,2,3,4)
InChIKeyRNDSHTAVZSZCLX-UHFFFAOYSA-N
MW371.33 g/mol
LogP3.19
Rot. Bonds3

About 2,3-diphenylbenzamide;phosphoric acid

2,3-diphenylbenzamide;phosphoric acid (PubChem CID 68745056) has the molecular formula C19H18NO5P and a molecular weight of 371.33 g/mol. Its IUPAC name is 2,3-diphenylbenzamide;phosphoric acid.

Molecular Properties

Compound Name2,3-diphenylbenzamide;phosphoric acid
PubChem CID68745056
Molecular FormulaC19H18NO5P
Molecular Weight371.33 g/mol
Exact Mass371.09
IUPAC Name2,3-diphenylbenzamide;phosphoric acid
SMILESNC(=O)c1cccc(-c2ccccc2)c1-c1ccccc1.O=P(O)(O)O
InChIInChI=1S/C19H15NO.H3O4P/c20-19(21)17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15;1-5(2,3)4/h1-13H,(H2,20,21);(H3,1,2,3,4)
InChIKeyRNDSHTAVZSZCLX-UHFFFAOYSA-N
XLogP3.19
TPSA120.85 Ų
H-Bond Donors4
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500371.33
LogP ≤ 53.19
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2,3-diphenylbenzamide;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-diphenylbenzamide;phosphoric acid?
The IUPAC name of 2,3-diphenylbenzamide;phosphoric acid (CID 68745056) is 2,3-diphenylbenzamide;phosphoric acid.
What is the SMILES notation for 2,3-diphenylbenzamide;phosphoric acid?
The canonical SMILES for 2,3-diphenylbenzamide;phosphoric acid is NC(=O)c1cccc(-c2ccccc2)c1-c1ccccc1.O=P(O)(O)O.
What is the InChIKey of 2,3-diphenylbenzamide;phosphoric acid?
The InChIKey is RNDSHTAVZSZCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO.H3O4P/c20-19(21)17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15;1-5(2,3)4/h1-13H,(H2,20,21);(H3,1,2,3,4).
What are the key properties of 2,3-diphenylbenzamide;phosphoric acid?
2,3-diphenylbenzamide;phosphoric acid has a molecular weight of 371.33 g/mol, XLogP of 3.19, 3 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylbenzamide;phosphoric acid is sourced from PubChem (CID 68745056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).