C19H18NO5P — CID 68745056
2,3-diphenylbenzamide;phosphoric acid (PubChem CID 68745056) has the molecular formula C19H18NO5P and a molecular weight of 371.33 g/mol. Its IUPAC name is 2,3-diphenylbenzamide;phosphoric acid.
| Compound Name | 2,3-diphenylbenzamide;phosphoric acid |
|---|---|
| PubChem CID | 68745056 |
| Molecular Formula | C19H18NO5P |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2,3-diphenylbenzamide;phosphoric acid |
| SMILES | NC(=O)c1cccc(-c2ccccc2)c1-c1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C19H15NO.H3O4P/c20-19(21)17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15;1-5(2,3)4/h1-13H,(H2,20,21);(H3,1,2,3,4) |
| InChIKey | RNDSHTAVZSZCLX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|