C18H19N2O4P — CID 163364903
3,4-diphenylbenzene-1,2-diamine;phosphoric acid (PubChem CID 163364903) has the molecular formula C18H19N2O4P and a molecular weight of 358.33 g/mol. Its IUPAC name is 3,4-diphenylbenzene-1,2-diamine;phosphoric acid.
| Compound Name | 3,4-diphenylbenzene-1,2-diamine;phosphoric acid |
|---|---|
| PubChem CID | 163364903 |
| Molecular Formula | C18H19N2O4P |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3,4-diphenylbenzene-1,2-diamine;phosphoric acid |
| SMILES | Nc1ccc(-c2ccccc2)c(-c2ccccc2)c1N.O=P(O)(O)O |
| InChI | InChI=1S/C18H16N2.H3O4P/c19-16-12-11-15(13-7-3-1-4-8-13)17(18(16)20)14-9-5-2-6-10-14;1-5(2,3)4/h1-12H,19-20H2;(H3,1,2,3,4) |
| InChIKey | MERRJJBOCLUTAS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|