C18H17N2O3P — CID 175850211
(4-amino-2,3-diphenylanilino)phosphonic acid (PubChem CID 175850211) has the molecular formula C18H17N2O3P and a molecular weight of 340.32 g/mol. Its IUPAC name is (4-amino-2,3-diphenylanilino)phosphonic acid.
| Compound Name | (4-amino-2,3-diphenylanilino)phosphonic acid |
|---|---|
| PubChem CID | 175850211 |
| Molecular Formula | C18H17N2O3P |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (4-amino-2,3-diphenylanilino)phosphonic acid |
| SMILES | Nc1ccc(NP(=O)(O)O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H17N2O3P/c19-15-11-12-16(20-24(21,22)23)18(14-9-5-2-6-10-14)17(15)13-7-3-1-4-8-13/h1-12H,19H2,(H3,20,21,22,23) |
| InChIKey | MCIJEHYIKTWDRD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|