About CID 158293488
CID 158293488 (PubChem CID 158293488) has the molecular formula C12H14NO5PS
and a molecular weight of 315.29 g/mol.
Molecular Properties
| Compound Name | CID 158293488 |
| PubChem CID | 158293488 |
| Molecular Formula | C12H14NO5PS |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | — |
| SMILES | NP(=O)(O)S(=O)(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.H4NO5PS/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-7(2,3)8(4,5)6/h1-10H;(H3,1,2,3)(H,4,5,6) |
| InChIKey | GLQCLJBUMBVLQF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 158293488 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158293488?
The IUPAC name of CID 158293488 (CID 158293488) is not available.
What is the SMILES notation for CID 158293488?
The canonical SMILES for CID 158293488 is NP(=O)(O)S(=O)(=O)O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of CID 158293488?
The InChIKey is GLQCLJBUMBVLQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.H4NO5PS/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-7(2,3)8(4,5)6/h1-10H;(H3,1,2,3)(H,4,5,6).
What are the key properties of CID 158293488?
CID 158293488 has a molecular weight of 315.29 g/mol, XLogP of 2.29, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158293488 is sourced from PubChem (CID 158293488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).