About 3-phenylbenzamide;phosphoric acid
3-phenylbenzamide;phosphoric acid (PubChem CID 130454344) has the molecular formula C13H14NO5P
and a molecular weight of 295.23 g/mol. Its IUPAC name is 3-phenylbenzamide;phosphoric acid.
Molecular Properties
| Compound Name | 3-phenylbenzamide;phosphoric acid |
| PubChem CID | 130454344 |
| Molecular Formula | C13H14NO5P |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-phenylbenzamide;phosphoric acid |
| SMILES | NC(=O)c1cccc(-c2ccccc2)c1.O=P(O)(O)O |
| InChI | InChI=1S/C13H11NO.H3O4P/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;1-5(2,3)4/h1-9H,(H2,14,15);(H3,1,2,3,4) |
| InChIKey | JTVVUMZXAHBBFK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylbenzamide;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbenzamide;phosphoric acid?
The IUPAC name of 3-phenylbenzamide;phosphoric acid (CID 130454344) is 3-phenylbenzamide;phosphoric acid.
What is the SMILES notation for 3-phenylbenzamide;phosphoric acid?
The canonical SMILES for 3-phenylbenzamide;phosphoric acid is NC(=O)c1cccc(-c2ccccc2)c1.O=P(O)(O)O.
What is the InChIKey of 3-phenylbenzamide;phosphoric acid?
The InChIKey is JTVVUMZXAHBBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.H3O4P/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;1-5(2,3)4/h1-9H,(H2,14,15);(H3,1,2,3,4).
What are the key properties of 3-phenylbenzamide;phosphoric acid?
3-phenylbenzamide;phosphoric acid has a molecular weight of 295.23 g/mol, XLogP of 1.52, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbenzamide;phosphoric acid is sourced from PubChem (CID 130454344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).