About 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride
3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride (PubChem CID 154810020) has the molecular formula C26H26Cl2N2O
and a molecular weight of 453.41 g/mol. Its IUPAC name is 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride |
| PubChem CID | 154810020 |
| Molecular Formula | C26H26Cl2N2O |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1cccc(-c2ccccc2)c1.NCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H11NO.C13H13N.2ClH/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12;;/h1-9H,(H2,14,15);1-9H,10,14H2;2*1H |
| InChIKey | NHWHQUBOLYQGEF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride?
The IUPAC name of 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride (CID 154810020) is 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride.
What is the SMILES notation for 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride?
The canonical SMILES for 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride is Cl.Cl.NC(=O)c1cccc(-c2ccccc2)c1.NCc1cccc(-c2ccccc2)c1.
What is the InChIKey of 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride?
The InChIKey is NHWHQUBOLYQGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.C13H13N.2ClH/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12;;/h1-9H,(H2,14,15);1-9H,10,14H2;2*1H.
What are the key properties of 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride?
3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride has a molecular weight of 453.41 g/mol, XLogP of 6.11, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbenzamide;(3-phenylphenyl)methanamine;dihydrochloride is sourced from PubChem (CID 154810020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).