C17H17NO — CID 143169964
3-[3-(2-methylprop-2-enyl)phenyl]benzamide (PubChem CID 143169964) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[3-(2-methylprop-2-enyl)phenyl]benzamide.
| Compound Name | 3-[3-(2-methylprop-2-enyl)phenyl]benzamide |
|---|---|
| PubChem CID | 143169964 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-[3-(2-methylprop-2-enyl)phenyl]benzamide |
| SMILES | C=C(C)Cc1cccc(-c2cccc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C17H17NO/c1-12(2)9-13-5-3-6-14(10-13)15-7-4-8-16(11-15)17(18)19/h3-8,10-11H,1,9H2,2H3,(H2,18,19) |
| InChIKey | VXAQDHHMQBYEOP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|