C19H17N2O4P — CID 69002653
[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]phosphonic acid (PubChem CID 69002653) has the molecular formula C19H17N2O4P and a molecular weight of 368.33 g/mol. Its IUPAC name is [4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]phosphonic acid.
| Compound Name | [4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 69002653 |
| Molecular Formula | C19H17N2O4P |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]phosphonic acid |
| SMILES | Nc1ccc(-c2ccccc2)cc1NC(=O)c1ccc(P(=O)(O)O)cc1 |
| InChI | InChI=1S/C19H17N2O4P/c20-17-11-8-15(13-4-2-1-3-5-13)12-18(17)21-19(22)14-6-9-16(10-7-14)26(23,24)25/h1-12H,20H2,(H,21,22)(H2,23,24,25) |
| InChIKey | MRTULDONXZKUAL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|