C23H25N2O3P — CID 25013304
N-(2-amino-5-phenylphenyl)-4-[[ethoxy(methyl)phosphoryl]methyl]benzamide (PubChem CID 25013304) has the molecular formula C23H25N2O3P and a molecular weight of 408.44 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[[ethoxy(methyl)phosphoryl]methyl]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[[ethoxy(methyl)phosphoryl]methyl]benzamide |
|---|---|
| PubChem CID | 25013304 |
| Molecular Formula | C23H25N2O3P |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[[ethoxy(methyl)phosphoryl]methyl]benzamide |
| SMILES | CCOP(C)(=O)Cc1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C23H25N2O3P/c1-3-28-29(2,27)16-17-9-11-19(12-10-17)23(26)25-22-15-20(13-14-21(22)24)18-7-5-4-6-8-18/h4-15H,3,16,24H2,1-2H3,(H,25,26) |
| InChIKey | CTWHIIYQRAXVAL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|