C29H26N2O2 — CID 59627328
N-(2-amino-5-phenylphenyl)-4-(3-oxo-4-phenylbutyl)benzamide (PubChem CID 59627328) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-(3-oxo-4-phenylbutyl)benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-(3-oxo-4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 59627328 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-(3-oxo-4-phenylbutyl)benzamide |
| SMILES | Nc1ccc(-c2ccccc2)cc1NC(=O)c1ccc(CCC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N2O2/c30-27-18-16-25(23-9-5-2-6-10-23)20-28(27)31-29(33)24-14-11-21(12-15-24)13-17-26(32)19-22-7-3-1-4-8-22/h1-12,14-16,18,20H,13,17,19,30H2,(H,31,33) |
| InChIKey | WPCMCUHFHRADTK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|