C23H23N3O3 — CID 91362734
[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]methyl N-ethylcarbamate (PubChem CID 91362734) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is [4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]methyl N-ethylcarbamate.
| Compound Name | [4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 91362734 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCc1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C23H23N3O3/c1-2-25-23(28)29-15-16-8-10-18(11-9-16)22(27)26-21-14-19(12-13-20(21)24)17-6-4-3-5-7-17/h3-14H,2,15,24H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | RGQPUGJZUQPGSE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|