C22H25N3O2 — CID 66894745
N-(2-amino-5-phenylphenyl)-4-methoxybenzamide;N-methylmethanamine (PubChem CID 66894745) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-methoxybenzamide;N-methylmethanamine.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-methoxybenzamide;N-methylmethanamine |
|---|---|
| PubChem CID | 66894745 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-methoxybenzamide;N-methylmethanamine |
| SMILES | CNC.COc1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C20H18N2O2.C2H7N/c1-24-17-10-7-15(8-11-17)20(23)22-19-13-16(9-12-18(19)21)14-5-3-2-4-6-14;1-3-2/h2-13H,21H2,1H3,(H,22,23);3H,1-2H3 |
| InChIKey | XOUMHHDWPPAMPU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|