C24H27N3O — CID 25158263
N-(2-amino-5-phenylphenyl)-4-[(2-methylpropylamino)methyl]benzamide (PubChem CID 25158263) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[(2-methylpropylamino)methyl]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[(2-methylpropylamino)methyl]benzamide |
|---|---|
| PubChem CID | 25158263 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[(2-methylpropylamino)methyl]benzamide |
| SMILES | CC(C)CNCc1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C24H27N3O/c1-17(2)15-26-16-18-8-10-20(11-9-18)24(28)27-23-14-21(12-13-22(23)25)19-6-4-3-5-7-19/h3-14,17,26H,15-16,25H2,1-2H3,(H,27,28) |
| InChIKey | LPGCYTKMQKYVFP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|