C26H28N2O2 — CID 59627338
N-(2-amino-5-phenylphenyl)-4-(5-methyl-3-oxohexyl)benzamide (PubChem CID 59627338) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-(5-methyl-3-oxohexyl)benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-(5-methyl-3-oxohexyl)benzamide |
|---|---|
| PubChem CID | 59627338 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-(5-methyl-3-oxohexyl)benzamide |
| SMILES | CC(C)CC(=O)CCc1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-18(2)16-23(29)14-10-19-8-11-21(12-9-19)26(30)28-25-17-22(13-15-24(25)27)20-6-4-3-5-7-20/h3-9,11-13,15,17-18H,10,14,16,27H2,1-2H3,(H,28,30) |
| InChIKey | GFZNYRRXPNNMBQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|