C23H25N3O — CID 174615601
N-(2-amino-5-phenyl-3-pyridinyl)-4-(3-methylbutyl)benzamide (PubChem CID 174615601) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(2-amino-5-phenyl-3-pyridinyl)-4-(3-methylbutyl)benzamide.
| Compound Name | N-(2-amino-5-phenyl-3-pyridinyl)-4-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 174615601 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-(2-amino-5-phenyl-3-pyridinyl)-4-(3-methylbutyl)benzamide |
| SMILES | CC(C)CCc1ccc(C(=O)Nc2cc(-c3ccccc3)cnc2N)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-16(2)8-9-17-10-12-19(13-11-17)23(27)26-21-14-20(15-25-22(21)24)18-6-4-3-5-7-18/h3-7,10-16H,8-9H2,1-2H3,(H2,24,25)(H,26,27) |
| InChIKey | FUONCQVQAUWXJR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |