C23H24FN2O4P — CID 87354168
[1-[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]-1-fluoroethyl]-ethoxyphosphinic acid (PubChem CID 87354168) has the molecular formula C23H24FN2O4P and a molecular weight of 442.43 g/mol. Its IUPAC name is [1-[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]-1-fluoroethyl]-ethoxyphosphinic acid.
| Compound Name | [1-[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]-1-fluoroethyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 87354168 |
| Molecular Formula | C23H24FN2O4P |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [1-[4-[(2-amino-5-phenylphenyl)carbamoyl]phenyl]-1-fluoroethyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(C)(F)c1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C23H24FN2O4P/c1-3-30-31(28,29)23(2,24)19-12-9-17(10-13-19)22(27)26-21-15-18(11-14-20(21)25)16-7-5-4-6-8-16/h4-15H,3,25H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | OJXZACQGGQHKHK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|