C27H32N3O2P — CID 143614079
N-(2-amino-5-phenylphenyl)-4-[[2-dimethylphosphanylethyl(propanoyl)amino]methyl]benzamide (PubChem CID 143614079) has the molecular formula C27H32N3O2P and a molecular weight of 461.55 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[[2-dimethylphosphanylethyl(propanoyl)amino]methyl]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[[2-dimethylphosphanylethyl(propanoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 143614079 |
| Molecular Formula | C27H32N3O2P |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[[2-dimethylphosphanylethyl(propanoyl)amino]methyl]benzamide |
| SMILES | CCC(=O)N(CCP(C)C)Cc1ccc(C(=O)Nc2cc(-c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C27H32N3O2P/c1-4-26(31)30(16-17-33(2)3)19-20-10-12-22(13-11-20)27(32)29-25-18-23(14-15-24(25)28)21-8-6-5-7-9-21/h5-15,18H,4,16-17,19,28H2,1-3H3,(H,29,32) |
| InChIKey | VYDFIIVERXKRGA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|