C21H18N2O — CID 46887334
N-[2-amino-5-(4-ethenylphenyl)phenyl]benzamide (PubChem CID 46887334) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[2-amino-5-(4-ethenylphenyl)phenyl]benzamide.
| Compound Name | N-[2-amino-5-(4-ethenylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46887334 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[2-amino-5-(4-ethenylphenyl)phenyl]benzamide |
| SMILES | C=Cc1ccc(-c2ccc(N)c(NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H18N2O/c1-2-15-8-10-16(11-9-15)18-12-13-19(22)20(14-18)23-21(24)17-6-4-3-5-7-17/h2-14H,1,22H2,(H,23,24) |
| InChIKey | GUBGWFHGNFMNFP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|