C23H23N3O2 — CID 59737305
N-(2-amino-5-phenylphenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]benzamide (PubChem CID 59737305) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 59737305 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]benzamide |
| SMILES | Nc1ccc(-c2ccccc2)cc1NC(=O)c1ccc(N2CC[C@H](O)C2)cc1 |
| InChI | InChI=1S/C23H23N3O2/c24-21-11-8-18(16-4-2-1-3-5-16)14-22(21)25-23(28)17-6-9-19(10-7-17)26-13-12-20(27)15-26/h1-11,14,20,27H,12-13,15,24H2,(H,25,28)/t20-/m0/s1 |
| InChIKey | MWLOOTLZOLTATJ-FQEVSTJZSA-N |
| XLogP | 3.76 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|