C18H20N4O3 — CID 69032775
[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl] carbamate (PubChem CID 69032775) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl] carbamate.
| Compound Name | [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 69032775 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl] carbamate |
| SMILES | NC(=O)O[C@H]1CCN(c2ccc(C(=O)Nc3ccccc3N)cc2)C1 |
| InChI | InChI=1S/C18H20N4O3/c19-15-3-1-2-4-16(15)21-17(23)12-5-7-13(8-6-12)22-10-9-14(11-22)25-18(20)24/h1-8,14H,9-11,19H2,(H2,20,24)(H,21,23)/t14-/m0/s1 |
| InChIKey | ZKLBSWAPHPBBHE-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|