C23H24N4O4 — CID 67420835
[(2S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]-2-(furan-3-ylmethyl)pyrrolidin-3-yl] carbamate (PubChem CID 67420835) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is [(2S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]-2-(furan-3-ylmethyl)pyrrolidin-3-yl] carbamate.
| Compound Name | [(2S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]-2-(furan-3-ylmethyl)pyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 67420835 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(2S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]-2-(furan-3-ylmethyl)pyrrolidin-3-yl] carbamate |
| SMILES | NC(=O)OC1CCN(c2ccc(C(=O)Nc3ccccc3N)cc2)[C@H]1Cc1ccoc1 |
| InChI | InChI=1S/C23H24N4O4/c24-18-3-1-2-4-19(18)26-22(28)16-5-7-17(8-6-16)27-11-9-21(31-23(25)29)20(27)13-15-10-12-30-14-15/h1-8,10,12,14,20-21H,9,11,13,24H2,(H2,25,29)(H,26,28)/t20-,21?/m0/s1 |
| InChIKey | QQGAPOUUPDZENL-BGERDNNASA-N |
| XLogP | 3.40 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|