C27H32N4O — CID 171354291
N-(2-aminophenyl)-4-[[(1-benzylpiperidin-4-yl)methylamino]methyl]benzamide (PubChem CID 171354291) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(1-benzylpiperidin-4-yl)methylamino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[(1-benzylpiperidin-4-yl)methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 171354291 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(1-benzylpiperidin-4-yl)methylamino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNCC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H32N4O/c28-25-8-4-5-9-26(25)30-27(32)24-12-10-21(11-13-24)18-29-19-22-14-16-31(17-15-22)20-23-6-2-1-3-7-23/h1-13,22,29H,14-20,28H2,(H,30,32) |
| InChIKey | WFPGMCDLBDDLAZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|