C29H33FN4O — CID 137422540
N-(2-aminophenyl)-4-[[4-fluoro-4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]methyl]benzamide (PubChem CID 137422540) has the molecular formula C29H33FN4O and a molecular weight of 472.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[4-fluoro-4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[4-fluoro-4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 137422540 |
| Molecular Formula | C29H33FN4O |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-(2-aminophenyl)-4-[[4-fluoro-4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]piperidin-1-yl]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN2CCC(F)(CN[C@@H]3C[C@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H33FN4O/c30-29(20-32-27-18-24(27)22-6-2-1-3-7-22)14-16-34(17-15-29)19-21-10-12-23(13-11-21)28(35)33-26-9-5-4-8-25(26)31/h1-13,24,27,32H,14-20,31H2,(H,33,35)/t24-,27+/m0/s1 |
| InChIKey | RGNBDAYVFLPCOT-RPLLCQBOSA-N |
| XLogP | 4.97 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|