C25H32N4O3S — CID 58417034
O-[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl] 4-morpholin-4-ylbutanethioate (PubChem CID 58417034) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is O-[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl] 4-morpholin-4-ylbutanethioate.
| Compound Name | O-[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl] 4-morpholin-4-ylbutanethioate |
|---|---|
| PubChem CID | 58417034 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | O-[(3S)-1-[4-[(2-aminophenyl)carbamoyl]phenyl]pyrrolidin-3-yl] 4-morpholin-4-ylbutanethioate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2CC[C@H](OC(=S)CCCN3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C25H32N4O3S/c26-22-4-1-2-5-23(22)27-25(30)19-7-9-20(10-8-19)29-13-11-21(18-29)32-24(33)6-3-12-28-14-16-31-17-15-28/h1-2,4-5,7-10,21H,3,6,11-18,26H2,(H,27,30)/t21-/m0/s1 |
| InChIKey | BBFCLWHNPOGESD-NRFANRHFSA-N |
| XLogP | 3.56 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|