C28H34N6O3 — CID 58000981
N-(2-aminophenyl)-4-[[(4-aminophenyl)carbamoyl-(3-morpholin-4-ylpropyl)amino]methyl]benzamide (PubChem CID 58000981) has the molecular formula C28H34N6O3 and a molecular weight of 502.62 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(4-aminophenyl)carbamoyl-(3-morpholin-4-ylpropyl)amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[(4-aminophenyl)carbamoyl-(3-morpholin-4-ylpropyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 58000981 |
| Molecular Formula | C28H34N6O3 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(4-aminophenyl)carbamoyl-(3-morpholin-4-ylpropyl)amino]methyl]benzamide |
| SMILES | Nc1ccc(NC(=O)N(CCCN2CCOCC2)Cc2ccc(C(=O)Nc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C28H34N6O3/c29-23-10-12-24(13-11-23)31-28(36)34(15-3-14-33-16-18-37-19-17-33)20-21-6-8-22(9-7-21)27(35)32-26-5-2-1-4-25(26)30/h1-2,4-13H,3,14-20,29-30H2,(H,31,36)(H,32,35) |
| InChIKey | LKJAPDGJFLYFPS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|