C25H30N6O3S — CID 59224973
N-(2-aminophenyl)-5-[[3-morpholin-4-ylpropyl(thiophen-3-ylcarbamoyl)amino]methyl]pyridine-2-carboxamide (PubChem CID 59224973) has the molecular formula C25H30N6O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[3-morpholin-4-ylpropyl(thiophen-3-ylcarbamoyl)amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[3-morpholin-4-ylpropyl(thiophen-3-ylcarbamoyl)amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59224973 |
| Molecular Formula | C25H30N6O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-(2-aminophenyl)-5-[[3-morpholin-4-ylpropyl(thiophen-3-ylcarbamoyl)amino]methyl]pyridine-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN(CCCN2CCOCC2)C(=O)Nc2ccsc2)cn1 |
| InChI | InChI=1S/C25H30N6O3S/c26-21-4-1-2-5-22(21)29-24(32)23-7-6-19(16-27-23)17-31(25(33)28-20-8-15-35-18-20)10-3-9-30-11-13-34-14-12-30/h1-2,4-8,15-16,18H,3,9-14,17,26H2,(H,28,33)(H,29,32) |
| InChIKey | HAZACTAFTWBDHV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|