C28H36N6O3S — CID 70252323
N-(4-aminothiophen-3-yl)-5-[[3-morpholin-4-ylpropyl(3-phenylpropylcarbamoyl)amino]methyl]pyridine-2-carboxamide (PubChem CID 70252323) has the molecular formula C28H36N6O3S and a molecular weight of 536.70 g/mol. Its IUPAC name is N-(4-aminothiophen-3-yl)-5-[[3-morpholin-4-ylpropyl(3-phenylpropylcarbamoyl)amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(4-aminothiophen-3-yl)-5-[[3-morpholin-4-ylpropyl(3-phenylpropylcarbamoyl)amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70252323 |
| Molecular Formula | C28H36N6O3S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | N-(4-aminothiophen-3-yl)-5-[[3-morpholin-4-ylpropyl(3-phenylpropylcarbamoyl)amino]methyl]pyridine-2-carboxamide |
| SMILES | Nc1cscc1NC(=O)c1ccc(CN(CCCN2CCOCC2)C(=O)NCCCc2ccccc2)cn1 |
| InChI | InChI=1S/C28H36N6O3S/c29-24-20-38-21-26(24)32-27(35)25-10-9-23(18-31-25)19-34(13-5-12-33-14-16-37-17-15-33)28(36)30-11-4-8-22-6-2-1-3-7-22/h1-3,6-7,9-10,18,20-21H,4-5,8,11-17,19,29H2,(H,30,36)(H,32,35) |
| InChIKey | FBNLQYXVMYXCKB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|