C30H38N6O4 — CID 59225224
N-(2-aminophenyl)-5-[[(2-methoxyphenyl)carbamoyl-(5-morpholin-4-ylpentyl)amino]methyl]pyridine-2-carboxamide (PubChem CID 59225224) has the molecular formula C30H38N6O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[(2-methoxyphenyl)carbamoyl-(5-morpholin-4-ylpentyl)amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[(2-methoxyphenyl)carbamoyl-(5-morpholin-4-ylpentyl)amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59225224 |
| Molecular Formula | C30H38N6O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | N-(2-aminophenyl)-5-[[(2-methoxyphenyl)carbamoyl-(5-morpholin-4-ylpentyl)amino]methyl]pyridine-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)N(CCCCCN1CCOCC1)Cc1ccc(C(=O)Nc2ccccc2N)nc1 |
| InChI | InChI=1S/C30H38N6O4/c1-39-28-12-6-5-11-26(28)34-30(38)36(16-8-2-7-15-35-17-19-40-20-18-35)22-23-13-14-27(32-21-23)29(37)33-25-10-4-3-9-24(25)31/h3-6,9-14,21H,2,7-8,15-20,22,31H2,1H3,(H,33,37)(H,34,38) |
| InChIKey | JQJQLWLGGLXTRY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|