C30H36FN6O5P — CID 145488757
[2-[[5-[[(3-fluoro-4-phosphanylphenyl)carbamoyl-(5-morpholin-4-ylpentyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamic acid (PubChem CID 145488757) has the molecular formula C30H36FN6O5P and a molecular weight of 610.63 g/mol. Its IUPAC name is [2-[[5-[[(3-fluoro-4-phosphanylphenyl)carbamoyl-(5-morpholin-4-ylpentyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamic acid.
| Compound Name | [2-[[5-[[(3-fluoro-4-phosphanylphenyl)carbamoyl-(5-morpholin-4-ylpentyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 145488757 |
| Molecular Formula | C30H36FN6O5P |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | [2-[[5-[[(3-fluoro-4-phosphanylphenyl)carbamoyl-(5-morpholin-4-ylpentyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccccc1NC(=O)c1ccc(CN(CCCCCN2CCOCC2)C(=O)Nc2ccc(P)c(F)c2)cn1 |
| InChI | InChI=1S/C30H36FN6O5P/c31-23-18-22(9-11-27(23)43)33-29(39)37(13-5-1-4-12-36-14-16-42-17-15-36)20-21-8-10-26(32-19-21)28(38)34-24-6-2-3-7-25(24)35-30(40)41/h2-3,6-11,18-19,35H,1,4-5,12-17,20,43H2,(H,33,39)(H,34,38)(H,40,41) |
| InChIKey | RPLICRUBMOIVJX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 136.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|