C31H40N6O4 — CID 89119876
N-(2-aminophenyl)-5-[[1-(3,4-dimethoxyanilino)ethenyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carboxamide (PubChem CID 89119876) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[1-(3,4-dimethoxyanilino)ethenyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[1-(3,4-dimethoxyanilino)ethenyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89119876 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | N-(2-aminophenyl)-5-[[1-(3,4-dimethoxyanilino)ethenyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carboxamide |
| SMILES | C=C(Nc1ccc(OC)c(OC)c1)N(CCCCN1CCOCC1)Cc1ccc(C(=O)Nc2ccccc2N)nc1 |
| InChI | InChI=1S/C31H40N6O4/c1-23(34-25-11-13-29(39-2)30(20-25)40-3)37(15-7-6-14-36-16-18-41-19-17-36)22-24-10-12-28(33-21-24)31(38)35-27-9-5-4-8-26(27)32/h4-5,8-13,20-21,34H,1,6-7,14-19,22,32H2,2-3H3,(H,35,38) |
| InChIKey | QPDAUICLRJWNED-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 114.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|