C37H50N6O4 — CID 89119934
5-[[1-(4-methoxyanilino)ethenyl-(5-morpholin-4-ylpentyl)amino]methyl]-N-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]phenyl]pyridine-2-carboxamide (PubChem CID 89119934) has the molecular formula C37H50N6O4 and a molecular weight of 642.85 g/mol. Its IUPAC name is 5-[[1-(4-methoxyanilino)ethenyl-(5-morpholin-4-ylpentyl)amino]methyl]-N-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]phenyl]pyridine-2-carboxamide.
| Compound Name | 5-[[1-(4-methoxyanilino)ethenyl-(5-morpholin-4-ylpentyl)amino]methyl]-N-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89119934 |
| Molecular Formula | C37H50N6O4 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | 5-[[1-(4-methoxyanilino)ethenyl-(5-morpholin-4-ylpentyl)amino]methyl]-N-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]phenyl]pyridine-2-carboxamide |
| SMILES | C=C(Nc1ccccc1NC(=O)c1ccc(CN(CCCCCN2CCOCC2)C(=C)Nc2ccc(OC)cc2)cn1)OC(C)(C)C |
| InChI | InChI=1S/C37H50N6O4/c1-28(39-31-15-17-32(45-6)18-16-31)43(21-11-7-10-20-42-22-24-46-25-23-42)27-30-14-19-35(38-26-30)36(44)41-34-13-9-8-12-33(34)40-29(2)47-37(3,4)5/h8-9,12-19,26,39-40H,1-2,7,10-11,20-25,27H2,3-6H3,(H,41,44) |
| InChIKey | MBZKDYKSPVXNBL-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 100.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|