C24H27N5O3 — CID 89119903
N-(2-aminophenyl)-5-[[2-hydroxyethyl-[1-(4-methoxyanilino)ethenyl]amino]methyl]pyridine-2-carboxamide (PubChem CID 89119903) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[2-hydroxyethyl-[1-(4-methoxyanilino)ethenyl]amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[2-hydroxyethyl-[1-(4-methoxyanilino)ethenyl]amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89119903 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-(2-aminophenyl)-5-[[2-hydroxyethyl-[1-(4-methoxyanilino)ethenyl]amino]methyl]pyridine-2-carboxamide |
| SMILES | C=C(Nc1ccc(OC)cc1)N(CCO)Cc1ccc(C(=O)Nc2ccccc2N)nc1 |
| InChI | InChI=1S/C24H27N5O3/c1-17(27-19-8-10-20(32-2)11-9-19)29(13-14-30)16-18-7-12-23(26-15-18)24(31)28-22-6-4-3-5-21(22)25/h3-12,15,27,30H,1,13-14,16,25H2,2H3,(H,28,31) |
| InChIKey | ZAVJMQWEHGMOSV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|