C24H26N6O4 — CID 59224928
2-[[6-[(2-aminophenyl)carbamoyl]-3-pyridinyl]methyl-[[4-(dimethylamino)phenyl]carbamoyl]amino]acetic acid (PubChem CID 59224928) has the molecular formula C24H26N6O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2-[[6-[(2-aminophenyl)carbamoyl]-3-pyridinyl]methyl-[[4-(dimethylamino)phenyl]carbamoyl]amino]acetic acid.
| Compound Name | 2-[[6-[(2-aminophenyl)carbamoyl]-3-pyridinyl]methyl-[[4-(dimethylamino)phenyl]carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 59224928 |
| Molecular Formula | C24H26N6O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-[[6-[(2-aminophenyl)carbamoyl]-3-pyridinyl]methyl-[[4-(dimethylamino)phenyl]carbamoyl]amino]acetic acid |
| SMILES | CN(C)c1ccc(NC(=O)N(CC(=O)O)Cc2ccc(C(=O)Nc3ccccc3N)nc2)cc1 |
| InChI | InChI=1S/C24H26N6O4/c1-29(2)18-10-8-17(9-11-18)27-24(34)30(15-22(31)32)14-16-7-12-21(26-13-16)23(33)28-20-6-4-3-5-19(20)25/h3-13H,14-15,25H2,1-2H3,(H,27,34)(H,28,33)(H,31,32) |
| InChIKey | JMHVWNKNOGSOAI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|