C24H27FN6O2 — CID 25030763
N-(2-aminophenyl)-5-[[2-(dimethylamino)ethyl-[(3-fluorophenyl)carbamoyl]amino]methyl]pyridine-2-carboxamide (PubChem CID 25030763) has the molecular formula C24H27FN6O2 and a molecular weight of 450.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[2-(dimethylamino)ethyl-[(3-fluorophenyl)carbamoyl]amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[2-(dimethylamino)ethyl-[(3-fluorophenyl)carbamoyl]amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25030763 |
| Molecular Formula | C24H27FN6O2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | N-(2-aminophenyl)-5-[[2-(dimethylamino)ethyl-[(3-fluorophenyl)carbamoyl]amino]methyl]pyridine-2-carboxamide |
| SMILES | CN(C)CCN(Cc1ccc(C(=O)Nc2ccccc2N)nc1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H27FN6O2/c1-30(2)12-13-31(24(33)28-19-7-5-6-18(25)14-19)16-17-10-11-22(27-15-17)23(32)29-21-9-4-3-8-20(21)26/h3-11,14-15H,12-13,16,26H2,1-2H3,(H,28,33)(H,29,32) |
| InChIKey | QFNMQZRVMHCHQA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|