C27H33FN6O2 — CID 59225226
N-(2-aminophenyl)-5-[[3-(diethylamino)propyl-[(3-fluorophenyl)carbamoyl]amino]methyl]pyridine-2-carboxamide (PubChem CID 59225226) has the molecular formula C27H33FN6O2 and a molecular weight of 492.60 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[3-(diethylamino)propyl-[(3-fluorophenyl)carbamoyl]amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[3-(diethylamino)propyl-[(3-fluorophenyl)carbamoyl]amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59225226 |
| Molecular Formula | C27H33FN6O2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | N-(2-aminophenyl)-5-[[3-(diethylamino)propyl-[(3-fluorophenyl)carbamoyl]amino]methyl]pyridine-2-carboxamide |
| SMILES | CCN(CC)CCCN(Cc1ccc(C(=O)Nc2ccccc2N)nc1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C27H33FN6O2/c1-3-33(4-2)15-8-16-34(27(36)31-22-10-7-9-21(28)17-22)19-20-13-14-25(30-18-20)26(35)32-24-12-6-5-11-23(24)29/h5-7,9-14,17-18H,3-4,8,15-16,19,29H2,1-2H3,(H,31,36)(H,32,35) |
| InChIKey | FLYKCFKQIORHRY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|