C25H29ClN6O2 — CID 59225101
N-(2-aminophenyl)-5-[[(3-chlorophenyl)carbamoyl-[3-(dimethylamino)propyl]amino]methyl]pyridine-2-carboxamide (PubChem CID 59225101) has the molecular formula C25H29ClN6O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[(3-chlorophenyl)carbamoyl-[3-(dimethylamino)propyl]amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[(3-chlorophenyl)carbamoyl-[3-(dimethylamino)propyl]amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59225101 |
| Molecular Formula | C25H29ClN6O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-(2-aminophenyl)-5-[[(3-chlorophenyl)carbamoyl-[3-(dimethylamino)propyl]amino]methyl]pyridine-2-carboxamide |
| SMILES | CN(C)CCCN(Cc1ccc(C(=O)Nc2ccccc2N)nc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H29ClN6O2/c1-31(2)13-6-14-32(25(34)29-20-8-5-7-19(26)15-20)17-18-11-12-23(28-16-18)24(33)30-22-10-4-3-9-21(22)27/h3-5,7-12,15-16H,6,13-14,17,27H2,1-2H3,(H,29,34)(H,30,33) |
| InChIKey | HMVYQMLWXZHDFC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|