C29H39N7O — CID 89124435
N-(2-aminophenyl)-5-[[1-[4-(dimethylamino)anilino]ethenyl-[4-(dimethylamino)butyl]amino]methyl]pyridine-2-carboxamide (PubChem CID 89124435) has the molecular formula C29H39N7O and a molecular weight of 501.68 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[1-[4-(dimethylamino)anilino]ethenyl-[4-(dimethylamino)butyl]amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[1-[4-(dimethylamino)anilino]ethenyl-[4-(dimethylamino)butyl]amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89124435 |
| Molecular Formula | C29H39N7O |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | N-(2-aminophenyl)-5-[[1-[4-(dimethylamino)anilino]ethenyl-[4-(dimethylamino)butyl]amino]methyl]pyridine-2-carboxamide |
| SMILES | C=C(Nc1ccc(N(C)C)cc1)N(CCCCN(C)C)Cc1ccc(C(=O)Nc2ccccc2N)nc1 |
| InChI | InChI=1S/C29H39N7O/c1-22(32-24-13-15-25(16-14-24)35(4)5)36(19-9-8-18-34(2)3)21-23-12-17-28(31-20-23)29(37)33-27-11-7-6-10-26(27)30/h6-7,10-17,20,32H,1,8-9,18-19,21,30H2,2-5H3,(H,33,37) |
| InChIKey | FVPLHIXVRSFQRJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|