C23H27N5O2S — CID 145488614
N-(2-aminophenyl)-5-[[pentyl(thiophen-3-ylcarbamoyl)amino]methyl]pyridine-2-carboxamide (PubChem CID 145488614) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[pentyl(thiophen-3-ylcarbamoyl)amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[pentyl(thiophen-3-ylcarbamoyl)amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 145488614 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-(2-aminophenyl)-5-[[pentyl(thiophen-3-ylcarbamoyl)amino]methyl]pyridine-2-carboxamide |
| SMILES | CCCCCN(Cc1ccc(C(=O)Nc2ccccc2N)nc1)C(=O)Nc1ccsc1 |
| InChI | InChI=1S/C23H27N5O2S/c1-2-3-6-12-28(23(30)26-18-11-13-31-16-18)15-17-9-10-21(25-14-17)22(29)27-20-8-5-4-7-19(20)24/h4-5,7-11,13-14,16H,2-3,6,12,15,24H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | VLSPOTVDBNIRDX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|