C32H46N6O5 — CID 59224985
tert-butyl N-[2-[[5-[[cyclopentylcarbamoyl(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate (PubChem CID 59224985) has the molecular formula C32H46N6O5 and a molecular weight of 594.76 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[[cyclopentylcarbamoyl(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[[cyclopentylcarbamoyl(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 59224985 |
| Molecular Formula | C32H46N6O5 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | tert-butyl N-[2-[[5-[[cyclopentylcarbamoyl(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)c1ccc(CN(CCCCN2CCOCC2)C(=O)NC2CCCC2)cn1 |
| InChI | InChI=1S/C32H46N6O5/c1-32(2,3)43-31(41)36-27-13-7-6-12-26(27)35-29(39)28-15-14-24(22-33-28)23-38(30(40)34-25-10-4-5-11-25)17-9-8-16-37-18-20-42-21-19-37/h6-7,12-15,22,25H,4-5,8-11,16-21,23H2,1-3H3,(H,34,40)(H,35,39)(H,36,41) |
| InChIKey | UNJSUTBOPYLVOO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|