C28H40N6O2 — CID 89124292
N-(2-aminophenyl)-5-[[1-(cyclopentylamino)ethenyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carboxamide (PubChem CID 89124292) has the molecular formula C28H40N6O2 and a molecular weight of 492.67 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[1-(cyclopentylamino)ethenyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[1-(cyclopentylamino)ethenyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89124292 |
| Molecular Formula | C28H40N6O2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | N-(2-aminophenyl)-5-[[1-(cyclopentylamino)ethenyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carboxamide |
| SMILES | C=C(NC1CCCC1)N(CCCCN1CCOCC1)Cc1ccc(C(=O)Nc2ccccc2N)nc1 |
| InChI | InChI=1S/C28H40N6O2/c1-22(31-24-8-2-3-9-24)34(15-7-6-14-33-16-18-36-19-17-33)21-23-12-13-27(30-20-23)28(35)32-26-11-5-4-10-25(26)29/h4-5,10-13,20,24,31H,1-3,6-9,14-19,21,29H2,(H,32,35) |
| InChIKey | RWNKNGNJULZWBL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|