C30H36N6O3 — CID 89119886
N-(2-aminophenyl)-5-[[3-morpholin-4-ylpropyl-[1-(phenacylamino)ethenyl]amino]methyl]pyridine-2-carboxamide (PubChem CID 89119886) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[3-morpholin-4-ylpropyl-[1-(phenacylamino)ethenyl]amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[3-morpholin-4-ylpropyl-[1-(phenacylamino)ethenyl]amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89119886 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | N-(2-aminophenyl)-5-[[3-morpholin-4-ylpropyl-[1-(phenacylamino)ethenyl]amino]methyl]pyridine-2-carboxamide |
| SMILES | C=C(NCC(=O)c1ccccc1)N(CCCN1CCOCC1)Cc1ccc(C(=O)Nc2ccccc2N)nc1 |
| InChI | InChI=1S/C30H36N6O3/c1-23(32-21-29(37)25-8-3-2-4-9-25)36(15-7-14-35-16-18-39-19-17-35)22-24-12-13-28(33-20-24)30(38)34-27-11-6-5-10-26(27)31/h2-6,8-13,20,32H,1,7,14-19,21-22,31H2,(H,34,38) |
| InChIKey | ATCTURBREORNBC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|