C35H47N7O5 — CID 59225046
tert-butyl N-[2-[[5-[[[4-(dimethylamino)phenyl]carbamoyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate (PubChem CID 59225046) has the molecular formula C35H47N7O5 and a molecular weight of 645.81 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[[[4-(dimethylamino)phenyl]carbamoyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[[[4-(dimethylamino)phenyl]carbamoyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 59225046 |
| Molecular Formula | C35H47N7O5 |
| Molecular Weight | 645.81 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | tert-butyl N-[2-[[5-[[[4-(dimethylamino)phenyl]carbamoyl-(4-morpholin-4-ylbutyl)amino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
| SMILES | CN(C)c1ccc(NC(=O)N(CCCCN2CCOCC2)Cc2ccc(C(=O)Nc3ccccc3NC(=O)OC(C)(C)C)nc2)cc1 |
| InChI | InChI=1S/C35H47N7O5/c1-35(2,3)47-34(45)39-30-11-7-6-10-29(30)38-32(43)31-17-12-26(24-36-31)25-42(19-9-8-18-41-20-22-46-23-21-41)33(44)37-27-13-15-28(16-14-27)40(4)5/h6-7,10-17,24H,8-9,18-23,25H2,1-5H3,(H,37,44)(H,38,43)(H,39,45) |
| InChIKey | LUORWQMAJQQIIQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.81 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|