C30H36N6O3 — CID 58001052
N-(2-aminophenyl)-4-[[[4-(dimethylamino)phenyl]carbamoyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]benzamide (PubChem CID 58001052) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[4-(dimethylamino)phenyl]carbamoyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[4-(dimethylamino)phenyl]carbamoyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 58001052 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[4-(dimethylamino)phenyl]carbamoyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)N(CCCN2CCCC2=O)Cc2ccc(C(=O)Nc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C30H36N6O3/c1-34(2)25-16-14-24(15-17-25)32-30(39)36(20-6-19-35-18-5-9-28(35)37)21-22-10-12-23(13-11-22)29(38)33-27-8-4-3-7-26(27)31/h3-4,7-8,10-17H,5-6,9,18-21,31H2,1-2H3,(H,32,39)(H,33,38) |
| InChIKey | OSLWPIXRJPPBNJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|